C33H29N3O5 — CID 126402080
[4-[[(5,7-dimethyl-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]-2-methoxyphenyl] 4-methoxybenzoate (PubChem CID 126402080) has the molecular formula C33H29N3O5 and a molecular weight of 547.61 g/mol. Its IUPAC name is [4-[[(5,7-dimethyl-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]-2-methoxyphenyl] 4-methoxybenzoate.
| Compound Name | [4-[[(5,7-dimethyl-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]-2-methoxyphenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 126402080 |
| Molecular Formula | C33H29N3O5 |
| Molecular Weight | 547.61 g/mol |
| Exact Mass | 547.21 |
| IUPAC Name | [4-[[(5,7-dimethyl-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]-2-methoxyphenyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc(C=NNC(=O)c3[nH]c4c(C)cc(C)cc4c3-c3ccccc3)cc2OC)cc1 |
| InChI | InChI=1S/C33H29N3O5/c1-20-16-21(2)30-26(17-20)29(23-8-6-5-7-9-23)31(35-30)32(37)36-34-19-22-10-15-27(28(18-22)40-4)41-33(38)24-11-13-25(39-3)14-12-24/h5-19,35H,1-4H3,(H,36,37) |
| InChIKey | KZORZYKXBDNNAR-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.61 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|