C32H26ClN3O4 — CID 126403568
[4-[[(5,7-dimethyl-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]-2-methoxyphenyl] 2-chlorobenzoate (PubChem CID 126403568) has the molecular formula C32H26ClN3O4 and a molecular weight of 552.03 g/mol. Its IUPAC name is [4-[[(5,7-dimethyl-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]-2-methoxyphenyl] 2-chlorobenzoate.
| Compound Name | [4-[[(5,7-dimethyl-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]-2-methoxyphenyl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 126403568 |
| Molecular Formula | C32H26ClN3O4 |
| Molecular Weight | 552.03 g/mol |
| Exact Mass | 551.16 |
| IUPAC Name | [4-[[(5,7-dimethyl-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]-2-methoxyphenyl] 2-chlorobenzoate |
| SMILES | COc1cc(C=NNC(=O)c2[nH]c3c(C)cc(C)cc3c2-c2ccccc2)ccc1OC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C32H26ClN3O4/c1-19-15-20(2)29-24(16-19)28(22-9-5-4-6-10-22)30(35-29)31(37)36-34-18-21-13-14-26(27(17-21)39-3)40-32(38)23-11-7-8-12-25(23)33/h4-18,35H,1-3H3,(H,36,37) |
| InChIKey | XLPAUTKPQGUUBN-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.03 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|