C31H23Cl2N3O4 — CID 126402753
[2-methoxy-4-[[(7-methyl-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate (PubChem CID 126402753) has the molecular formula C31H23Cl2N3O4 and a molecular weight of 572.45 g/mol. Its IUPAC name is [2-methoxy-4-[[(7-methyl-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate.
| Compound Name | [2-methoxy-4-[[(7-methyl-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 126402753 |
| Molecular Formula | C31H23Cl2N3O4 |
| Molecular Weight | 572.45 g/mol |
| Exact Mass | 571.11 |
| IUPAC Name | [2-methoxy-4-[[(7-methyl-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate |
| SMILES | COc1cc(C=NNC(=O)c2[nH]c3c(C)cccc3c2-c2ccccc2)ccc1OC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C31H23Cl2N3O4/c1-18-7-6-10-23-27(20-8-4-3-5-9-20)29(35-28(18)23)30(37)36-34-17-19-11-14-25(26(15-19)39-2)40-31(38)22-13-12-21(32)16-24(22)33/h3-17,35H,1-2H3,(H,36,37) |
| InChIKey | RSLDGJHUJGNFCS-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.45 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|