C29H22ClN3O5 — CID 126403062
[4-[[[3-(2-chlorophenyl)-7-methyl-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-methoxyphenyl] furan-2-carboxylate (PubChem CID 126403062) has the molecular formula C29H22ClN3O5 and a molecular weight of 527.96 g/mol. Its IUPAC name is [4-[[[3-(2-chlorophenyl)-7-methyl-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-methoxyphenyl] furan-2-carboxylate.
| Compound Name | [4-[[[3-(2-chlorophenyl)-7-methyl-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-methoxyphenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 126403062 |
| Molecular Formula | C29H22ClN3O5 |
| Molecular Weight | 527.96 g/mol |
| Exact Mass | 527.12 |
| IUPAC Name | [4-[[[3-(2-chlorophenyl)-7-methyl-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-methoxyphenyl] furan-2-carboxylate |
| SMILES | COc1cc(C=NNC(=O)c2[nH]c3c(C)cccc3c2-c2ccccc2Cl)ccc1OC(=O)c1ccco1 |
| InChI | InChI=1S/C29H22ClN3O5/c1-17-7-5-9-20-25(19-8-3-4-10-21(19)30)27(32-26(17)20)28(34)33-31-16-18-12-13-22(24(15-18)36-2)38-29(35)23-11-6-14-37-23/h3-16,32H,1-2H3,(H,33,34) |
| InChIKey | UFMVGDCGSWIRRM-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.96 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|