C31H23ClFN3O4 — CID 126403774
[4-[[[3-(2-chlorophenyl)-7-fluoro-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-methylbenzoate (PubChem CID 126403774) has the molecular formula C31H23ClFN3O4 and a molecular weight of 555.99 g/mol. Its IUPAC name is [4-[[[3-(2-chlorophenyl)-7-fluoro-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-methylbenzoate.
| Compound Name | [4-[[[3-(2-chlorophenyl)-7-fluoro-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 126403774 |
| Molecular Formula | C31H23ClFN3O4 |
| Molecular Weight | 555.99 g/mol |
| Exact Mass | 555.14 |
| IUPAC Name | [4-[[[3-(2-chlorophenyl)-7-fluoro-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-methylbenzoate |
| SMILES | COc1cc(C=NNC(=O)c2[nH]c3c(F)cccc3c2-c2ccccc2Cl)ccc1OC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C31H23ClFN3O4/c1-18-10-13-20(14-11-18)31(38)40-25-15-12-19(16-26(25)39-2)17-34-36-30(37)29-27(21-6-3-4-8-23(21)32)22-7-5-9-24(33)28(22)35-29/h3-17,35H,1-2H3,(H,36,37) |
| InChIKey | YNEFINQEGSTOIN-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.99 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|