C34H29ClFN3O6 — CID 126402370
[4-[[[3-(2-chlorophenyl)-7-fluoro-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3,4-diethoxybenzoate (PubChem CID 126402370) has the molecular formula C34H29ClFN3O6 and a molecular weight of 630.07 g/mol. Its IUPAC name is [4-[[[3-(2-chlorophenyl)-7-fluoro-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3,4-diethoxybenzoate.
| Compound Name | [4-[[[3-(2-chlorophenyl)-7-fluoro-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3,4-diethoxybenzoate |
|---|---|
| PubChem CID | 126402370 |
| Molecular Formula | C34H29ClFN3O6 |
| Molecular Weight | 630.07 g/mol |
| Exact Mass | 629.17 |
| IUPAC Name | [4-[[[3-(2-chlorophenyl)-7-fluoro-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3,4-diethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)Oc2ccc(C=NNC(=O)c3[nH]c4c(F)cccc4c3-c3ccccc3Cl)cc2OC)cc1OCC |
| InChI | InChI=1S/C34H29ClFN3O6/c1-4-43-26-16-14-21(18-29(26)44-5-2)34(41)45-27-15-13-20(17-28(27)42-3)19-37-39-33(40)32-30(22-9-6-7-11-24(22)35)23-10-8-12-25(36)31(23)38-32/h6-19,38H,4-5H2,1-3H3,(H,39,40) |
| InChIKey | OLXGLTFHGLKFHP-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.07 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|