C32H22Cl2F3N3O4 — CID 126400647
[4-[[[7-chloro-3-(2-chlorophenyl)-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 3-(trifluoromethyl)benzoate (PubChem CID 126400647) has the molecular formula C32H22Cl2F3N3O4 and a molecular weight of 640.45 g/mol. Its IUPAC name is [4-[[[7-chloro-3-(2-chlorophenyl)-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 3-(trifluoromethyl)benzoate.
| Compound Name | [4-[[[7-chloro-3-(2-chlorophenyl)-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 3-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 126400647 |
| Molecular Formula | C32H22Cl2F3N3O4 |
| Molecular Weight | 640.45 g/mol |
| Exact Mass | 639.09 |
| IUPAC Name | [4-[[[7-chloro-3-(2-chlorophenyl)-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 3-(trifluoromethyl)benzoate |
| SMILES | CCOc1cc(C=NNC(=O)c2[nH]c3c(Cl)cccc3c2-c2ccccc2Cl)ccc1OC(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C32H22Cl2F3N3O4/c1-2-43-26-15-18(13-14-25(26)44-31(42)19-7-5-8-20(16-19)32(35,36)37)17-38-40-30(41)29-27(21-9-3-4-11-23(21)33)22-10-6-12-24(34)28(22)39-29/h3-17,39H,2H2,1H3,(H,40,41) |
| InChIKey | AHXBCVYMXAEIIS-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.45 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|