C31H21ClF3N3O4 — CID 126401438
[2-[[[3-(2-chlorophenyl)-7-methoxy-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 3-(trifluoromethyl)benzoate (PubChem CID 126401438) has the molecular formula C31H21ClF3N3O4 and a molecular weight of 591.97 g/mol. Its IUPAC name is [2-[[[3-(2-chlorophenyl)-7-methoxy-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 3-(trifluoromethyl)benzoate.
| Compound Name | [2-[[[3-(2-chlorophenyl)-7-methoxy-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 3-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 126401438 |
| Molecular Formula | C31H21ClF3N3O4 |
| Molecular Weight | 591.97 g/mol |
| Exact Mass | 591.12 |
| IUPAC Name | [2-[[[3-(2-chlorophenyl)-7-methoxy-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 3-(trifluoromethyl)benzoate |
| SMILES | COc1cccc2c(-c3ccccc3Cl)c(C(=O)NN=Cc3ccccc3OC(=O)c3cccc(C(F)(F)F)c3)[nH]c12 |
| InChI | InChI=1S/C31H21ClF3N3O4/c1-41-25-15-7-12-22-26(21-11-3-4-13-23(21)32)28(37-27(22)25)29(39)38-36-17-19-8-2-5-14-24(19)42-30(40)18-9-6-10-20(16-18)31(33,34)35/h2-17,37H,1H3,(H,38,39) |
| InChIKey | CPIYPPYTIWKQCF-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.97 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|