C32H24F3N3O5 — CID 126401888
[2-[[(4,7-dimethoxy-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 3-(trifluoromethyl)benzoate (PubChem CID 126401888) has the molecular formula C32H24F3N3O5 and a molecular weight of 587.55 g/mol. Its IUPAC name is [2-[[(4,7-dimethoxy-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 3-(trifluoromethyl)benzoate.
| Compound Name | [2-[[(4,7-dimethoxy-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 3-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 126401888 |
| Molecular Formula | C32H24F3N3O5 |
| Molecular Weight | 587.55 g/mol |
| Exact Mass | 587.17 |
| IUPAC Name | [2-[[(4,7-dimethoxy-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 3-(trifluoromethyl)benzoate |
| SMILES | COc1ccc(OC)c2c(-c3ccccc3)c(C(=O)NN=Cc3ccccc3OC(=O)c3cccc(C(F)(F)F)c3)[nH]c12 |
| InChI | InChI=1S/C32H24F3N3O5/c1-41-24-15-16-25(42-2)28-27(24)26(19-9-4-3-5-10-19)29(37-28)30(39)38-36-18-21-11-6-7-14-23(21)43-31(40)20-12-8-13-22(17-20)32(33,34)35/h3-18,37H,1-2H3,(H,38,39) |
| InChIKey | IXCUMIOGZGTEDI-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.55 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|