C35H31Cl2N3O6 — CID 126400776
[4-[[[7-chloro-3-(2-chlorophenyl)-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 3,4-diethoxybenzoate (PubChem CID 126400776) has the molecular formula C35H31Cl2N3O6 and a molecular weight of 660.55 g/mol. Its IUPAC name is [4-[[[7-chloro-3-(2-chlorophenyl)-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 3,4-diethoxybenzoate.
| Compound Name | [4-[[[7-chloro-3-(2-chlorophenyl)-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 3,4-diethoxybenzoate |
|---|---|
| PubChem CID | 126400776 |
| Molecular Formula | C35H31Cl2N3O6 |
| Molecular Weight | 660.55 g/mol |
| Exact Mass | 659.16 |
| IUPAC Name | [4-[[[7-chloro-3-(2-chlorophenyl)-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 3,4-diethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)Oc2ccc(C=NNC(=O)c3[nH]c4c(Cl)cccc4c3-c3ccccc3Cl)cc2OCC)cc1OCC |
| InChI | InChI=1S/C35H31Cl2N3O6/c1-4-43-27-17-15-22(19-30(27)45-6-3)35(42)46-28-16-14-21(18-29(28)44-5-2)20-38-40-34(41)33-31(23-10-7-8-12-25(23)36)24-11-9-13-26(37)32(24)39-33/h7-20,39H,4-6H2,1-3H3,(H,40,41) |
| InChIKey | HUHCJTJAWZAKDG-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.55 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|