C32H22Cl3N3O6 — CID 126402175
[4-[[[5,7-dichloro-3-(2-chlorophenyl)-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 1,3-benzodioxole-5-carboxylate (PubChem CID 126402175) has the molecular formula C32H22Cl3N3O6 and a molecular weight of 650.90 g/mol. Its IUPAC name is [4-[[[5,7-dichloro-3-(2-chlorophenyl)-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 1,3-benzodioxole-5-carboxylate.
| Compound Name | [4-[[[5,7-dichloro-3-(2-chlorophenyl)-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 126402175 |
| Molecular Formula | C32H22Cl3N3O6 |
| Molecular Weight | 650.90 g/mol |
| Exact Mass | 649.06 |
| IUPAC Name | [4-[[[5,7-dichloro-3-(2-chlorophenyl)-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 1,3-benzodioxole-5-carboxylate |
| SMILES | CCOc1cc(C=NNC(=O)c2[nH]c3c(Cl)cc(Cl)cc3c2-c2ccccc2Cl)ccc1OC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C32H22Cl3N3O6/c1-2-41-26-11-17(7-9-25(26)44-32(40)18-8-10-24-27(12-18)43-16-42-24)15-36-38-31(39)30-28(20-5-3-4-6-22(20)34)21-13-19(33)14-23(35)29(21)37-30/h3-15,37H,2,16H2,1H3,(H,38,39) |
| InChIKey | MDJUQRJLUXCPEL-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.90 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|