C31H21BrCl3N3O4 — CID 126400922
[4-[[[5-bromo-7-chloro-3-(2-chlorophenyl)-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 2-chlorobenzoate (PubChem CID 126400922) has the molecular formula C31H21BrCl3N3O4 and a molecular weight of 685.79 g/mol. Its IUPAC name is [4-[[[5-bromo-7-chloro-3-(2-chlorophenyl)-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 2-chlorobenzoate.
| Compound Name | [4-[[[5-bromo-7-chloro-3-(2-chlorophenyl)-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 126400922 |
| Molecular Formula | C31H21BrCl3N3O4 |
| Molecular Weight | 685.79 g/mol |
| Exact Mass | 682.98 |
| IUPAC Name | [4-[[[5-bromo-7-chloro-3-(2-chlorophenyl)-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 2-chlorobenzoate |
| SMILES | CCOc1cc(C=NNC(=O)c2[nH]c3c(Cl)cc(Br)cc3c2-c2ccccc2Cl)ccc1OC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C31H21BrCl3N3O4/c1-2-41-26-13-17(11-12-25(26)42-31(40)20-8-4-6-10-23(20)34)16-36-38-30(39)29-27(19-7-3-5-9-22(19)33)21-14-18(32)15-24(35)28(21)37-29/h3-16,37H,2H2,1H3,(H,38,39) |
| InChIKey | OGBABRAENKIRMD-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.79 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|