C36H27Cl2N3O5 — CID 126401029
[4-[[[3-(2-chlorophenyl)-1H-benzo[g]indole-2-carbonyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 5-chloro-2-methoxybenzoate (PubChem CID 126401029) has the molecular formula C36H27Cl2N3O5 and a molecular weight of 652.53 g/mol. Its IUPAC name is [4-[[[3-(2-chlorophenyl)-1H-benzo[g]indole-2-carbonyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 5-chloro-2-methoxybenzoate.
| Compound Name | [4-[[[3-(2-chlorophenyl)-1H-benzo[g]indole-2-carbonyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 5-chloro-2-methoxybenzoate |
|---|---|
| PubChem CID | 126401029 |
| Molecular Formula | C36H27Cl2N3O5 |
| Molecular Weight | 652.53 g/mol |
| Exact Mass | 651.13 |
| IUPAC Name | [4-[[[3-(2-chlorophenyl)-1H-benzo[g]indole-2-carbonyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 5-chloro-2-methoxybenzoate |
| SMILES | CCOc1cc(C=NNC(=O)c2[nH]c3c(ccc4ccccc43)c2-c2ccccc2Cl)ccc1OC(=O)c1cc(Cl)ccc1OC |
| InChI | InChI=1S/C36H27Cl2N3O5/c1-3-45-31-18-21(12-16-30(31)46-36(43)27-19-23(37)14-17-29(27)44-2)20-39-41-35(42)34-32(25-10-6-7-11-28(25)38)26-15-13-22-8-4-5-9-24(22)33(26)40-34/h4-20,40H,3H2,1-2H3,(H,41,42) |
| InChIKey | SRFTUBZKPNGWOW-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.53 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|