C31H22Cl3N3O5 — CID 126403872
[4-[[[5-chloro-3-(2-chlorophenyl)-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-methoxyphenyl] 5-chloro-2-methoxybenzoate (PubChem CID 126403872) has the molecular formula C31H22Cl3N3O5 and a molecular weight of 622.89 g/mol. Its IUPAC name is [4-[[[5-chloro-3-(2-chlorophenyl)-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-methoxyphenyl] 5-chloro-2-methoxybenzoate.
| Compound Name | [4-[[[5-chloro-3-(2-chlorophenyl)-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-methoxyphenyl] 5-chloro-2-methoxybenzoate |
|---|---|
| PubChem CID | 126403872 |
| Molecular Formula | C31H22Cl3N3O5 |
| Molecular Weight | 622.89 g/mol |
| Exact Mass | 621.06 |
| IUPAC Name | [4-[[[5-chloro-3-(2-chlorophenyl)-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-methoxyphenyl] 5-chloro-2-methoxybenzoate |
| SMILES | COc1cc(C=NNC(=O)c2[nH]c3ccc(Cl)cc3c2-c2ccccc2Cl)ccc1OC(=O)c1cc(Cl)ccc1OC |
| InChI | InChI=1S/C31H22Cl3N3O5/c1-40-25-12-9-19(33)15-22(25)31(39)42-26-11-7-17(13-27(26)41-2)16-35-37-30(38)29-28(20-5-3-4-6-23(20)34)21-14-18(32)8-10-24(21)36-29/h3-16,36H,1-2H3,(H,37,38) |
| InChIKey | ZNNULEJWQBJJKJ-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.89 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|