C32H25Cl3N4O4 — CID 126402173
[4-[[[3-(2-chlorophenyl)-5-(dimethylamino)-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-methoxyphenyl] 2,4-dichlorobenzoate (PubChem CID 126402173) has the molecular formula C32H25Cl3N4O4 and a molecular weight of 635.94 g/mol. Its IUPAC name is [4-[[[3-(2-chlorophenyl)-5-(dimethylamino)-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-methoxyphenyl] 2,4-dichlorobenzoate.
| Compound Name | [4-[[[3-(2-chlorophenyl)-5-(dimethylamino)-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-methoxyphenyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 126402173 |
| Molecular Formula | C32H25Cl3N4O4 |
| Molecular Weight | 635.94 g/mol |
| Exact Mass | 634.09 |
| IUPAC Name | [4-[[[3-(2-chlorophenyl)-5-(dimethylamino)-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-methoxyphenyl] 2,4-dichlorobenzoate |
| SMILES | COc1cc(C=NNC(=O)c2[nH]c3ccc(N(C)C)cc3c2-c2ccccc2Cl)ccc1OC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C32H25Cl3N4O4/c1-39(2)20-10-12-26-23(16-20)29(21-6-4-5-7-24(21)34)30(37-26)31(40)38-36-17-18-8-13-27(28(14-18)42-3)43-32(41)22-11-9-19(33)15-25(22)35/h4-17,37H,1-3H3,(H,38,40) |
| InChIKey | MDDTUDAJJYOWLS-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.94 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|