C31H23BrClN3O4 — CID 126402022
[4-[[[5-bromo-3-(2-chlorophenyl)-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-methylbenzoate (PubChem CID 126402022) has the molecular formula C31H23BrClN3O4 and a molecular weight of 616.90 g/mol. Its IUPAC name is [4-[[[5-bromo-3-(2-chlorophenyl)-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-methylbenzoate.
| Compound Name | [4-[[[5-bromo-3-(2-chlorophenyl)-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 126402022 |
| Molecular Formula | C31H23BrClN3O4 |
| Molecular Weight | 616.90 g/mol |
| Exact Mass | 615.06 |
| IUPAC Name | [4-[[[5-bromo-3-(2-chlorophenyl)-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-methylbenzoate |
| SMILES | COc1cc(C=NNC(=O)c2[nH]c3ccc(Br)cc3c2-c2ccccc2Cl)ccc1OC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C31H23BrClN3O4/c1-18-7-10-20(11-8-18)31(38)40-26-14-9-19(15-27(26)39-2)17-34-36-30(37)29-28(22-5-3-4-6-24(22)33)23-16-21(32)12-13-25(23)35-29/h3-17,35H,1-2H3,(H,36,37) |
| InChIKey | KIAFFUVFKXFOHA-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.90 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|