C34H29BrClN3O7 — CID 126402299
[4-[[(5-bromo-7-chloro-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]-2-ethoxyphenyl] 3,4,5-trimethoxybenzoate (PubChem CID 126402299) has the molecular formula C34H29BrClN3O7 and a molecular weight of 706.98 g/mol. Its IUPAC name is [4-[[(5-bromo-7-chloro-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]-2-ethoxyphenyl] 3,4,5-trimethoxybenzoate.
| Compound Name | [4-[[(5-bromo-7-chloro-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]-2-ethoxyphenyl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 126402299 |
| Molecular Formula | C34H29BrClN3O7 |
| Molecular Weight | 706.98 g/mol |
| Exact Mass | 705.09 |
| IUPAC Name | [4-[[(5-bromo-7-chloro-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]-2-ethoxyphenyl] 3,4,5-trimethoxybenzoate |
| SMILES | CCOc1cc(C=NNC(=O)c2[nH]c3c(Cl)cc(Br)cc3c2-c2ccccc2)ccc1OC(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C34H29BrClN3O7/c1-5-45-26-13-19(11-12-25(26)46-34(41)21-14-27(42-2)32(44-4)28(15-21)43-3)18-37-39-33(40)31-29(20-9-7-6-8-10-20)23-16-22(35)17-24(36)30(23)38-31/h6-18,38H,5H2,1-4H3,(H,39,40) |
| InChIKey | NSHLVVIRZIKOAR-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.98 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|