C32H24Br2ClN3O6 — CID 126399014
[4-bromo-2-[[(5-bromo-7-chloro-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 3,4,5-trimethoxybenzoate (PubChem CID 126399014) has the molecular formula C32H24Br2ClN3O6 and a molecular weight of 741.82 g/mol. Its IUPAC name is [4-bromo-2-[[(5-bromo-7-chloro-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 3,4,5-trimethoxybenzoate.
| Compound Name | [4-bromo-2-[[(5-bromo-7-chloro-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 126399014 |
| Molecular Formula | C32H24Br2ClN3O6 |
| Molecular Weight | 741.82 g/mol |
| Exact Mass | 738.97 |
| IUPAC Name | [4-bromo-2-[[(5-bromo-7-chloro-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)Oc2ccc(Br)cc2C=NNC(=O)c2[nH]c3c(Cl)cc(Br)cc3c2-c2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C32H24Br2ClN3O6/c1-41-25-12-18(13-26(42-2)30(25)43-3)32(40)44-24-10-9-20(33)11-19(24)16-36-38-31(39)29-27(17-7-5-4-6-8-17)22-14-21(34)15-23(35)28(22)37-29/h4-16,37H,1-3H3,(H,38,39) |
| InChIKey | AVEVGLDEYYVJPZ-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.82 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|