C30H19BrCl3N3O4 — CID 126400316
[4-bromo-2-[[(5,7-dichloro-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 5-chloro-2-methoxybenzoate (PubChem CID 126400316) has the molecular formula C30H19BrCl3N3O4 and a molecular weight of 671.76 g/mol. Its IUPAC name is [4-bromo-2-[[(5,7-dichloro-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 5-chloro-2-methoxybenzoate.
| Compound Name | [4-bromo-2-[[(5,7-dichloro-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 5-chloro-2-methoxybenzoate |
|---|---|
| PubChem CID | 126400316 |
| Molecular Formula | C30H19BrCl3N3O4 |
| Molecular Weight | 671.76 g/mol |
| Exact Mass | 668.96 |
| IUPAC Name | [4-bromo-2-[[(5,7-dichloro-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 5-chloro-2-methoxybenzoate |
| SMILES | COc1ccc(Cl)cc1C(=O)Oc1ccc(Br)cc1C=NNC(=O)c1[nH]c2c(Cl)cc(Cl)cc2c1-c1ccccc1 |
| InChI | InChI=1S/C30H19BrCl3N3O4/c1-40-25-10-8-19(32)12-21(25)30(39)41-24-9-7-18(31)11-17(24)15-35-37-29(38)28-26(16-5-3-2-4-6-16)22-13-20(33)14-23(34)27(22)36-28/h2-15,36H,1H3,(H,37,38) |
| InChIKey | ROTQDNVWCZGTLF-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.76 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|