C30H21Cl2N3O4 — CID 126401329
[2-[[(5-chloro-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 5-chloro-2-methoxybenzoate (PubChem CID 126401329) has the molecular formula C30H21Cl2N3O4 and a molecular weight of 558.42 g/mol. Its IUPAC name is [2-[[(5-chloro-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 5-chloro-2-methoxybenzoate.
| Compound Name | [2-[[(5-chloro-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 5-chloro-2-methoxybenzoate |
|---|---|
| PubChem CID | 126401329 |
| Molecular Formula | C30H21Cl2N3O4 |
| Molecular Weight | 558.42 g/mol |
| Exact Mass | 557.09 |
| IUPAC Name | [2-[[(5-chloro-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 5-chloro-2-methoxybenzoate |
| SMILES | COc1ccc(Cl)cc1C(=O)Oc1ccccc1C=NNC(=O)c1[nH]c2ccc(Cl)cc2c1-c1ccccc1 |
| InChI | InChI=1S/C30H21Cl2N3O4/c1-38-26-14-12-21(32)16-23(26)30(37)39-25-10-6-5-9-19(25)17-33-35-29(36)28-27(18-7-3-2-4-8-18)22-15-20(31)11-13-24(22)34-28/h2-17,34H,1H3,(H,35,36) |
| InChIKey | BDGOFGRZLBKXCI-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.42 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|