C32H25Cl2N3O6 — CID 126403867
[2-[[[3-(2-chlorophenyl)-4,7-dimethoxy-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 5-chloro-2-methoxybenzoate (PubChem CID 126403867) has the molecular formula C32H25Cl2N3O6 and a molecular weight of 618.47 g/mol. Its IUPAC name is [2-[[[3-(2-chlorophenyl)-4,7-dimethoxy-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 5-chloro-2-methoxybenzoate.
| Compound Name | [2-[[[3-(2-chlorophenyl)-4,7-dimethoxy-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 5-chloro-2-methoxybenzoate |
|---|---|
| PubChem CID | 126403867 |
| Molecular Formula | C32H25Cl2N3O6 |
| Molecular Weight | 618.47 g/mol |
| Exact Mass | 617.11 |
| IUPAC Name | [2-[[[3-(2-chlorophenyl)-4,7-dimethoxy-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 5-chloro-2-methoxybenzoate |
| SMILES | COc1ccc(Cl)cc1C(=O)Oc1ccccc1C=NNC(=O)c1[nH]c2c(OC)ccc(OC)c2c1-c1ccccc1Cl |
| InChI | InChI=1S/C32H25Cl2N3O6/c1-40-24-13-12-19(33)16-21(24)32(39)43-23-11-7-4-8-18(23)17-35-37-31(38)30-27(20-9-5-6-10-22(20)34)28-25(41-2)14-15-26(42-3)29(28)36-30/h4-17,36H,1-3H3,(H,37,38) |
| InChIKey | ZMKHSQQEYFHWCT-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.47 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|