C30H24ClN3O7 — CID 126402867
[4-[[[3-(2-chlorophenyl)-4,7-dimethoxy-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-methoxyphenyl] furan-2-carboxylate (PubChem CID 126402867) has the molecular formula C30H24ClN3O7 and a molecular weight of 573.99 g/mol. Its IUPAC name is [4-[[[3-(2-chlorophenyl)-4,7-dimethoxy-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-methoxyphenyl] furan-2-carboxylate.
| Compound Name | [4-[[[3-(2-chlorophenyl)-4,7-dimethoxy-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-methoxyphenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 126402867 |
| Molecular Formula | C30H24ClN3O7 |
| Molecular Weight | 573.99 g/mol |
| Exact Mass | 573.13 |
| IUPAC Name | [4-[[[3-(2-chlorophenyl)-4,7-dimethoxy-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-methoxyphenyl] furan-2-carboxylate |
| SMILES | COc1cc(C=NNC(=O)c2[nH]c3c(OC)ccc(OC)c3c2-c2ccccc2Cl)ccc1OC(=O)c1ccco1 |
| InChI | InChI=1S/C30H24ClN3O7/c1-37-21-12-13-22(38-2)27-26(21)25(18-7-4-5-8-19(18)31)28(33-27)29(35)34-32-16-17-10-11-20(24(15-17)39-3)41-30(36)23-9-6-14-40-23/h4-16,33H,1-3H3,(H,34,35) |
| InChIKey | SNFCWQRJBJDDJT-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 124.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.99 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|