C29H20N4O5 — CID 126403435
[4-[[(7-cyano-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]-2-methoxyphenyl] furan-2-carboxylate (PubChem CID 126403435) has the molecular formula C29H20N4O5 and a molecular weight of 504.50 g/mol. Its IUPAC name is [4-[[(7-cyano-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]-2-methoxyphenyl] furan-2-carboxylate.
| Compound Name | [4-[[(7-cyano-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]-2-methoxyphenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 126403435 |
| Molecular Formula | C29H20N4O5 |
| Molecular Weight | 504.50 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | [4-[[(7-cyano-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]-2-methoxyphenyl] furan-2-carboxylate |
| SMILES | COc1cc(C=NNC(=O)c2[nH]c3c(C#N)cccc3c2-c2ccccc2)ccc1OC(=O)c1ccco1 |
| InChI | InChI=1S/C29H20N4O5/c1-36-24-15-18(12-13-22(24)38-29(35)23-11-6-14-37-23)17-31-33-28(34)27-25(19-7-3-2-4-8-19)21-10-5-9-20(16-30)26(21)32-27/h2-15,17,32H,1H3,(H,33,34) |
| InChIKey | WFZVKTUIFUVVNZ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 129.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.50 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|