C30H20N4O3 — CID 126399683
[2-[[(7-cyano-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] benzoate (PubChem CID 126399683) has the molecular formula C30H20N4O3 and a molecular weight of 484.52 g/mol. Its IUPAC name is [2-[[(7-cyano-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] benzoate.
| Compound Name | [2-[[(7-cyano-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] benzoate |
|---|---|
| PubChem CID | 126399683 |
| Molecular Formula | C30H20N4O3 |
| Molecular Weight | 484.52 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | [2-[[(7-cyano-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] benzoate |
| SMILES | N#Cc1cccc2c(-c3ccccc3)c(C(=O)NN=Cc3ccccc3OC(=O)c3ccccc3)[nH]c12 |
| InChI | InChI=1S/C30H20N4O3/c31-18-22-15-9-16-24-26(20-10-3-1-4-11-20)28(33-27(22)24)29(35)34-32-19-23-14-7-8-17-25(23)37-30(36)21-12-5-2-6-13-21/h1-17,19,33H,(H,34,35) |
| InChIKey | KHSYYBPTKMEYKG-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 107.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.52 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|