C31H20N4O5 — CID 126402873
[2-[[(7-cyano-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate (PubChem CID 126402873) has the molecular formula C31H20N4O5 and a molecular weight of 528.52 g/mol. Its IUPAC name is [2-[[(7-cyano-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate.
| Compound Name | [2-[[(7-cyano-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 126402873 |
| Molecular Formula | C31H20N4O5 |
| Molecular Weight | 528.52 g/mol |
| Exact Mass | 528.14 |
| IUPAC Name | [2-[[(7-cyano-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate |
| SMILES | N#Cc1cccc2c(-c3ccccc3)c(C(=O)NN=Cc3ccccc3OC(=O)c3ccc4c(c3)OCO4)[nH]c12 |
| InChI | InChI=1S/C31H20N4O5/c32-16-21-10-6-11-23-27(19-7-2-1-3-8-19)29(34-28(21)23)30(36)35-33-17-22-9-4-5-12-24(22)40-31(37)20-13-14-25-26(15-20)39-18-38-25/h1-15,17,34H,18H2,(H,35,36) |
| InChIKey | SOLXVAJTPWSZLA-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 125.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.52 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|