C31H17Br2ClN4O5 — CID 126400376
[2,4-dibromo-6-[[[3-(2-chlorophenyl)-7-cyano-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate (PubChem CID 126400376) has the molecular formula C31H17Br2ClN4O5 and a molecular weight of 720.76 g/mol. Its IUPAC name is [2,4-dibromo-6-[[[3-(2-chlorophenyl)-7-cyano-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate.
| Compound Name | [2,4-dibromo-6-[[[3-(2-chlorophenyl)-7-cyano-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 126400376 |
| Molecular Formula | C31H17Br2ClN4O5 |
| Molecular Weight | 720.76 g/mol |
| Exact Mass | 717.93 |
| IUPAC Name | [2,4-dibromo-6-[[[3-(2-chlorophenyl)-7-cyano-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate |
| SMILES | N#Cc1cccc2c(-c3ccccc3Cl)c(C(=O)NN=Cc3cc(Br)cc(Br)c3OC(=O)c3ccc4c(c3)OCO4)[nH]c12 |
| InChI | InChI=1S/C31H17Br2ClN4O5/c32-19-10-18(29(22(33)12-19)43-31(40)16-8-9-24-25(11-16)42-15-41-24)14-36-38-30(39)28-26(20-5-1-2-7-23(20)34)21-6-3-4-17(13-35)27(21)37-28/h1-12,14,37H,15H2,(H,38,39) |
| InChIKey | SFMYFOXYTZXDFK-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 125.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.76 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|