C30H20FN3O5 — CID 126401638
[2-[[(5-fluoro-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate (PubChem CID 126401638) has the molecular formula C30H20FN3O5 and a molecular weight of 521.50 g/mol. Its IUPAC name is [2-[[(5-fluoro-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate.
| Compound Name | [2-[[(5-fluoro-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 126401638 |
| Molecular Formula | C30H20FN3O5 |
| Molecular Weight | 521.50 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | [2-[[(5-fluoro-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate |
| SMILES | O=C(Oc1ccccc1C=NNC(=O)c1[nH]c2ccc(F)cc2c1-c1ccccc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C30H20FN3O5/c31-21-11-12-23-22(15-21)27(18-6-2-1-3-7-18)28(33-23)29(35)34-32-16-20-8-4-5-9-24(20)39-30(36)19-10-13-25-26(14-19)38-17-37-25/h1-16,33H,17H2,(H,34,35) |
| InChIKey | GCAFQUDVVYYMIP-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.50 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|