C33H28BrN3O6 — CID 126400982
[4-[[(4-bromo-7-methoxy-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]-2-ethoxyphenyl] 3-methoxybenzoate (PubChem CID 126400982) has the molecular formula C33H28BrN3O6 and a molecular weight of 642.51 g/mol. Its IUPAC name is [4-[[(4-bromo-7-methoxy-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]-2-ethoxyphenyl] 3-methoxybenzoate.
| Compound Name | [4-[[(4-bromo-7-methoxy-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]-2-ethoxyphenyl] 3-methoxybenzoate |
|---|---|
| PubChem CID | 126400982 |
| Molecular Formula | C33H28BrN3O6 |
| Molecular Weight | 642.51 g/mol |
| Exact Mass | 641.12 |
| IUPAC Name | [4-[[(4-bromo-7-methoxy-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]-2-ethoxyphenyl] 3-methoxybenzoate |
| SMILES | CCOc1cc(C=NNC(=O)c2[nH]c3c(OC)ccc(Br)c3c2-c2ccccc2)ccc1OC(=O)c1cccc(OC)c1 |
| InChI | InChI=1S/C33H28BrN3O6/c1-4-42-27-17-20(13-15-25(27)43-33(39)22-11-8-12-23(18-22)40-2)19-35-37-32(38)31-28(21-9-6-5-7-10-21)29-24(34)14-16-26(41-3)30(29)36-31/h5-19,36H,4H2,1-3H3,(H,37,38) |
| InChIKey | QNFMRCKQHZFZPO-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.51 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|