C32H26IN3O5 — CID 126402533
[2-ethoxy-4-[[(7-iodo-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 4-methoxybenzoate (PubChem CID 126402533) has the molecular formula C32H26IN3O5 and a molecular weight of 659.48 g/mol. Its IUPAC name is [2-ethoxy-4-[[(7-iodo-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 4-methoxybenzoate.
| Compound Name | [2-ethoxy-4-[[(7-iodo-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 126402533 |
| Molecular Formula | C32H26IN3O5 |
| Molecular Weight | 659.48 g/mol |
| Exact Mass | 659.09 |
| IUPAC Name | [2-ethoxy-4-[[(7-iodo-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] 4-methoxybenzoate |
| SMILES | CCOc1cc(C=NNC(=O)c2[nH]c3c(I)cccc3c2-c2ccccc2)ccc1OC(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C32H26IN3O5/c1-3-40-27-18-20(12-17-26(27)41-32(38)22-13-15-23(39-2)16-14-22)19-34-36-31(37)30-28(21-8-5-4-6-9-21)24-10-7-11-25(33)29(24)35-30/h4-19,35H,3H2,1-2H3,(H,36,37) |
| InChIKey | PYUYMKGYNUUOMJ-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.48 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|