C31H23Cl2N3O5 — CID 126401791
[4-[[(4,6-dichloro-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]-2-methoxyphenyl] 3-methoxybenzoate (PubChem CID 126401791) has the molecular formula C31H23Cl2N3O5 and a molecular weight of 588.45 g/mol. Its IUPAC name is [4-[[(4,6-dichloro-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]-2-methoxyphenyl] 3-methoxybenzoate.
| Compound Name | [4-[[(4,6-dichloro-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]-2-methoxyphenyl] 3-methoxybenzoate |
|---|---|
| PubChem CID | 126401791 |
| Molecular Formula | C31H23Cl2N3O5 |
| Molecular Weight | 588.45 g/mol |
| Exact Mass | 587.10 |
| IUPAC Name | [4-[[(4,6-dichloro-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]-2-methoxyphenyl] 3-methoxybenzoate |
| SMILES | COc1cccc(C(=O)Oc2ccc(C=NNC(=O)c3[nH]c4cc(Cl)cc(Cl)c4c3-c3ccccc3)cc2OC)c1 |
| InChI | InChI=1S/C31H23Cl2N3O5/c1-39-22-10-6-9-20(14-22)31(38)41-25-12-11-18(13-26(25)40-2)17-34-36-30(37)29-27(19-7-4-3-5-8-19)28-23(33)15-21(32)16-24(28)35-29/h3-17,35H,1-2H3,(H,36,37) |
| InChIKey | HWNHVFVKYZNUQP-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.45 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|