C34H28Cl3N3O7 — CID 126401302
[4-[[[4,6-dichloro-3-(2-chlorophenyl)-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 3,4,5-trimethoxybenzoate (PubChem CID 126401302) has the molecular formula C34H28Cl3N3O7 and a molecular weight of 696.97 g/mol. Its IUPAC name is [4-[[[4,6-dichloro-3-(2-chlorophenyl)-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 3,4,5-trimethoxybenzoate.
| Compound Name | [4-[[[4,6-dichloro-3-(2-chlorophenyl)-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 126401302 |
| Molecular Formula | C34H28Cl3N3O7 |
| Molecular Weight | 696.97 g/mol |
| Exact Mass | 695.10 |
| IUPAC Name | [4-[[[4,6-dichloro-3-(2-chlorophenyl)-1H-indole-2-carbonyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 3,4,5-trimethoxybenzoate |
| SMILES | CCOc1cc(C=NNC(=O)c2[nH]c3cc(Cl)cc(Cl)c3c2-c2ccccc2Cl)ccc1OC(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C34H28Cl3N3O7/c1-5-46-26-12-18(10-11-25(26)47-34(42)19-13-27(43-2)32(45-4)28(14-19)44-3)17-38-40-33(41)31-29(21-8-6-7-9-22(21)36)30-23(37)15-20(35)16-24(30)39-31/h6-17,39H,5H2,1-4H3,(H,40,41) |
| InChIKey | AVWFJYGFPNLAFP-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.97 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|