C35H30Br2ClN3O7 — CID 126398967
[2,4-dibromo-6-[[[3-(2-chlorophenyl)-4,7-dimethoxy-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 3,4-diethoxybenzoate (PubChem CID 126398967) has the molecular formula C35H30Br2ClN3O7 and a molecular weight of 799.90 g/mol. Its IUPAC name is [2,4-dibromo-6-[[[3-(2-chlorophenyl)-4,7-dimethoxy-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 3,4-diethoxybenzoate.
| Compound Name | [2,4-dibromo-6-[[[3-(2-chlorophenyl)-4,7-dimethoxy-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 3,4-diethoxybenzoate |
|---|---|
| PubChem CID | 126398967 |
| Molecular Formula | C35H30Br2ClN3O7 |
| Molecular Weight | 799.90 g/mol |
| Exact Mass | 797.01 |
| IUPAC Name | [2,4-dibromo-6-[[[3-(2-chlorophenyl)-4,7-dimethoxy-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 3,4-diethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)Oc2c(Br)cc(Br)cc2C=NNC(=O)c2[nH]c3c(OC)ccc(OC)c3c2-c2ccccc2Cl)cc1OCC |
| InChI | InChI=1S/C35H30Br2ClN3O7/c1-5-46-25-12-11-19(16-28(25)47-6-2)35(43)48-33-20(15-21(36)17-23(33)37)18-39-41-34(42)32-29(22-9-7-8-10-24(22)38)30-26(44-3)13-14-27(45-4)31(30)40-32/h7-18,40H,5-6H2,1-4H3,(H,41,42) |
| InChIKey | AGKAGKMMQQUEFU-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.90 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|