C31H23BrClN3O3 — CID 126401628
[2-[[[3-(2-chlorophenyl)-5,7-dimethyl-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate (PubChem CID 126401628) has the molecular formula C31H23BrClN3O3 and a molecular weight of 600.90 g/mol. Its IUPAC name is [2-[[[3-(2-chlorophenyl)-5,7-dimethyl-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate.
| Compound Name | [2-[[[3-(2-chlorophenyl)-5,7-dimethyl-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate |
|---|---|
| PubChem CID | 126401628 |
| Molecular Formula | C31H23BrClN3O3 |
| Molecular Weight | 600.90 g/mol |
| Exact Mass | 599.06 |
| IUPAC Name | [2-[[[3-(2-chlorophenyl)-5,7-dimethyl-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate |
| SMILES | Cc1cc(C)c2[nH]c(C(=O)NN=Cc3ccccc3OC(=O)c3ccc(Br)cc3)c(-c3ccccc3Cl)c2c1 |
| InChI | InChI=1S/C31H23BrClN3O3/c1-18-15-19(2)28-24(16-18)27(23-8-4-5-9-25(23)33)29(35-28)30(37)36-34-17-21-7-3-6-10-26(21)39-31(38)20-11-13-22(32)14-12-20/h3-17,35H,1-2H3,(H,36,37) |
| InChIKey | FZZXZTGONKMKEV-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.90 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|