C23H15BrN4O6 — CID 6241633
[2-bromo-6-[(Z)-[[2-(2-cyanophenoxy)acetyl]hydrazinylidene]methyl]-4-nitrophenyl] benzoate (PubChem CID 6241633) has the molecular formula C23H15BrN4O6 and a molecular weight of 523.30 g/mol. Its IUPAC name is [2-bromo-6-[(Z)-[[2-(2-cyanophenoxy)acetyl]hydrazinylidene]methyl]-4-nitrophenyl] benzoate.
| Compound Name | [2-bromo-6-[(Z)-[[2-(2-cyanophenoxy)acetyl]hydrazinylidene]methyl]-4-nitrophenyl] benzoate |
|---|---|
| PubChem CID | 6241633 |
| Molecular Formula | C23H15BrN4O6 |
| Molecular Weight | 523.30 g/mol |
| Exact Mass | 522.02 |
| IUPAC Name | [2-bromo-6-[(Z)-[[2-(2-cyanophenoxy)acetyl]hydrazinylidene]methyl]-4-nitrophenyl] benzoate |
| SMILES | N#Cc1ccccc1OCC(=O)N/N=C\c1cc([N+](=O)[O-])cc(Br)c1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H15BrN4O6/c24-19-11-18(28(31)32)10-17(22(19)34-23(30)15-6-2-1-3-7-15)13-26-27-21(29)14-33-20-9-5-4-8-16(20)12-25/h1-11,13H,14H2,(H,27,29)/b26-13- |
| InChIKey | KBQYSTHUIPMNNN-ZMFRSBBQSA-N |
| XLogP | 3.98 |
| TPSA | 143.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.30 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|