C21H13BrN4O7 — CID 6322734
[4-bromo-2-[(E)-[[2-(2-cyanophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 5-nitrofuran-2-carboxylate (PubChem CID 6322734) has the molecular formula C21H13BrN4O7 and a molecular weight of 513.26 g/mol. Its IUPAC name is [4-bromo-2-[(E)-[[2-(2-cyanophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 5-nitrofuran-2-carboxylate.
| Compound Name | [4-bromo-2-[(E)-[[2-(2-cyanophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 5-nitrofuran-2-carboxylate |
|---|---|
| PubChem CID | 6322734 |
| Molecular Formula | C21H13BrN4O7 |
| Molecular Weight | 513.26 g/mol |
| Exact Mass | 512.00 |
| IUPAC Name | [4-bromo-2-[(E)-[[2-(2-cyanophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 5-nitrofuran-2-carboxylate |
| SMILES | N#Cc1ccccc1OCC(=O)N/N=C/c1cc(Br)ccc1OC(=O)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C21H13BrN4O7/c22-15-5-6-17(33-21(28)18-7-8-20(32-18)26(29)30)14(9-15)11-24-25-19(27)12-31-16-4-2-1-3-13(16)10-23/h1-9,11H,12H2,(H,25,27)/b24-11+ |
| InChIKey | TUTQTHVATNIWQY-BHGWPJFGSA-N |
| XLogP | 3.57 |
| TPSA | 157.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.26 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|