C23H18BrN3O6 — CID 3404303
[4-bromo-2-[[[2-(2-nitrophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 2-methylbenzoate (PubChem CID 3404303) has the molecular formula C23H18BrN3O6 and a molecular weight of 512.32 g/mol. Its IUPAC name is [4-bromo-2-[[[2-(2-nitrophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 2-methylbenzoate.
| Compound Name | [4-bromo-2-[[[2-(2-nitrophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 2-methylbenzoate |
|---|---|
| PubChem CID | 3404303 |
| Molecular Formula | C23H18BrN3O6 |
| Molecular Weight | 512.32 g/mol |
| Exact Mass | 511.04 |
| IUPAC Name | [4-bromo-2-[[[2-(2-nitrophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 2-methylbenzoate |
| SMILES | Cc1ccccc1C(=O)Oc1ccc(Br)cc1C=NNC(=O)COc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H18BrN3O6/c1-15-6-2-3-7-18(15)23(29)33-20-11-10-17(24)12-16(20)13-25-26-22(28)14-32-21-9-5-4-8-19(21)27(30)31/h2-13H,14H2,1H3,(H,26,28) |
| InChIKey | VTADCBZXINLCSQ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 120.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.32 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|