C16H11N5O7 — CID 135419880
2-(2-cyanophenoxy)-N-[(E)-(2-hydroxy-3,5-dinitrophenyl)methylideneamino]acetamide (PubChem CID 135419880) has the molecular formula C16H11N5O7 and a molecular weight of 385.29 g/mol. Its IUPAC name is 2-(2-cyanophenoxy)-N-[(E)-(2-hydroxy-3,5-dinitrophenyl)methylideneamino]acetamide.
| Compound Name | 2-(2-cyanophenoxy)-N-[(E)-(2-hydroxy-3,5-dinitrophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 135419880 |
| Molecular Formula | C16H11N5O7 |
| Molecular Weight | 385.29 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | 2-(2-cyanophenoxy)-N-[(E)-(2-hydroxy-3,5-dinitrophenyl)methylideneamino]acetamide |
| SMILES | N#Cc1ccccc1OCC(=O)N/N=C/c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C16H11N5O7/c17-7-10-3-1-2-4-14(10)28-9-15(22)19-18-8-11-5-12(20(24)25)6-13(16(11)23)21(26)27/h1-6,8,23H,9H2,(H,19,22)/b18-8+ |
| InChIKey | WRVGTJINSVHJCU-QGMBQPNBSA-N |
| XLogP | 1.61 |
| TPSA | 180.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.29 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|