C17H16N4O7 — CID 135644095
2-(2,4-dimethylphenoxy)-N-[(Z)-(2-hydroxy-3,5-dinitrophenyl)methylideneamino]acetamide (PubChem CID 135644095) has the molecular formula C17H16N4O7 and a molecular weight of 388.34 g/mol. Its IUPAC name is 2-(2,4-dimethylphenoxy)-N-[(Z)-(2-hydroxy-3,5-dinitrophenyl)methylideneamino]acetamide.
| Compound Name | 2-(2,4-dimethylphenoxy)-N-[(Z)-(2-hydroxy-3,5-dinitrophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 135644095 |
| Molecular Formula | C17H16N4O7 |
| Molecular Weight | 388.34 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 2-(2,4-dimethylphenoxy)-N-[(Z)-(2-hydroxy-3,5-dinitrophenyl)methylideneamino]acetamide |
| SMILES | Cc1ccc(OCC(=O)N/N=C\c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2O)c(C)c1 |
| InChI | InChI=1S/C17H16N4O7/c1-10-3-4-15(11(2)5-10)28-9-16(22)19-18-8-12-6-13(20(24)25)7-14(17(12)23)21(26)27/h3-8,23H,9H2,1-2H3,(H,19,22)/b18-8- |
| InChIKey | ZCRJTNDMMSGCEL-LSCVHKIXSA-N |
| XLogP | 2.35 |
| TPSA | 157.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|