C19H20N4O7 — CID 135876553
2-[4-[(2S)-butan-2-yl]phenoxy]-N-[(E)-(2-hydroxy-3,5-dinitrophenyl)methylideneamino]acetamide (PubChem CID 135876553) has the molecular formula C19H20N4O7 and a molecular weight of 416.39 g/mol. Its IUPAC name is 2-[4-[(2S)-butan-2-yl]phenoxy]-N-[(E)-(2-hydroxy-3,5-dinitrophenyl)methylideneamino]acetamide.
| Compound Name | 2-[4-[(2S)-butan-2-yl]phenoxy]-N-[(E)-(2-hydroxy-3,5-dinitrophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 135876553 |
| Molecular Formula | C19H20N4O7 |
| Molecular Weight | 416.39 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 2-[4-[(2S)-butan-2-yl]phenoxy]-N-[(E)-(2-hydroxy-3,5-dinitrophenyl)methylideneamino]acetamide |
| SMILES | CC[C@H](C)c1ccc(OCC(=O)N/N=C/c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2O)cc1 |
| InChI | InChI=1S/C19H20N4O7/c1-3-12(2)13-4-6-16(7-5-13)30-11-18(24)21-20-10-14-8-15(22(26)27)9-17(19(14)25)23(28)29/h4-10,12,25H,3,11H2,1-2H3,(H,21,24)/b20-10+/t12-/m0/s1 |
| InChIKey | GYOUVIIFTLIKAT-QDBSGRMGSA-N |
| XLogP | 3.25 |
| TPSA | 157.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|