C19H20Br2N2O3 — CID 135644121
2-(4-butan-2-ylphenoxy)-N-[(Z)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]acetamide (PubChem CID 135644121) has the molecular formula C19H20Br2N2O3 and a molecular weight of 484.19 g/mol. Its IUPAC name is 2-(4-butan-2-ylphenoxy)-N-[(Z)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(4-butan-2-ylphenoxy)-N-[(Z)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 135644121 |
| Molecular Formula | C19H20Br2N2O3 |
| Molecular Weight | 484.19 g/mol |
| Exact Mass | 481.98 |
| IUPAC Name | 2-(4-butan-2-ylphenoxy)-N-[(Z)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]acetamide |
| SMILES | CCC(C)c1ccc(OCC(=O)N/N=C\c2cc(Br)cc(Br)c2O)cc1 |
| InChI | InChI=1S/C19H20Br2N2O3/c1-3-12(2)13-4-6-16(7-5-13)26-11-18(24)23-22-10-14-8-15(20)9-17(21)19(14)25/h4-10,12,25H,3,11H2,1-2H3,(H,23,24)/b22-10- |
| InChIKey | GPNUHKKWZHJYOD-YVNNLAQVSA-N |
| XLogP | 4.96 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.19 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|