C20H23BrN2O4 — CID 135642449
N-[(Z)-(5-bromo-2-hydroxy-3-methoxyphenyl)methylideneamino]-2-(4-butan-2-ylphenoxy)acetamide (PubChem CID 135642449) has the molecular formula C20H23BrN2O4 and a molecular weight of 435.32 g/mol. Its IUPAC name is N-[(Z)-(5-bromo-2-hydroxy-3-methoxyphenyl)methylideneamino]-2-(4-butan-2-ylphenoxy)acetamide.
| Compound Name | N-[(Z)-(5-bromo-2-hydroxy-3-methoxyphenyl)methylideneamino]-2-(4-butan-2-ylphenoxy)acetamide |
|---|---|
| PubChem CID | 135642449 |
| Molecular Formula | C20H23BrN2O4 |
| Molecular Weight | 435.32 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | N-[(Z)-(5-bromo-2-hydroxy-3-methoxyphenyl)methylideneamino]-2-(4-butan-2-ylphenoxy)acetamide |
| SMILES | CCC(C)c1ccc(OCC(=O)N/N=C\c2cc(Br)cc(OC)c2O)cc1 |
| InChI | InChI=1S/C20H23BrN2O4/c1-4-13(2)14-5-7-17(8-6-14)27-12-19(24)23-22-11-15-9-16(21)10-18(26-3)20(15)25/h5-11,13,25H,4,12H2,1-3H3,(H,23,24)/b22-11- |
| InChIKey | AUEVQFHMNABJGA-JJFYIABZSA-N |
| XLogP | 4.21 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.32 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|