C19H20BrN3O5 — CID 135579298
N-[(E)-(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-2-(4-butan-2-ylphenoxy)acetamide (PubChem CID 135579298) has the molecular formula C19H20BrN3O5 and a molecular weight of 450.29 g/mol. Its IUPAC name is N-[(E)-(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-2-(4-butan-2-ylphenoxy)acetamide.
| Compound Name | N-[(E)-(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-2-(4-butan-2-ylphenoxy)acetamide |
|---|---|
| PubChem CID | 135579298 |
| Molecular Formula | C19H20BrN3O5 |
| Molecular Weight | 450.29 g/mol |
| Exact Mass | 449.06 |
| IUPAC Name | N-[(E)-(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-2-(4-butan-2-ylphenoxy)acetamide |
| SMILES | CCC(C)c1ccc(OCC(=O)N/N=C/c2cc(Br)cc([N+](=O)[O-])c2O)cc1 |
| InChI | InChI=1S/C19H20BrN3O5/c1-3-12(2)13-4-6-16(7-5-13)28-11-18(24)22-21-10-14-8-15(20)9-17(19(14)25)23(26)27/h4-10,12,25H,3,11H2,1-2H3,(H,22,24)/b21-10+ |
| InChIKey | XAFKCARIYWJMHA-UFFVCSGVSA-N |
| XLogP | 4.11 |
| TPSA | 114.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.29 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|