C27H28N4O8 — CID 98241255
2-[4-[(2S)-butan-2-yl]phenoxy]-N-[(Z)-[4-(2,4-dinitrophenoxy)-3-ethoxyphenyl]methylideneamino]acetamide (PubChem CID 98241255) has the molecular formula C27H28N4O8 and a molecular weight of 536.54 g/mol. Its IUPAC name is 2-[4-[(2S)-butan-2-yl]phenoxy]-N-[(Z)-[4-(2,4-dinitrophenoxy)-3-ethoxyphenyl]methylideneamino]acetamide.
| Compound Name | 2-[4-[(2S)-butan-2-yl]phenoxy]-N-[(Z)-[4-(2,4-dinitrophenoxy)-3-ethoxyphenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 98241255 |
| Molecular Formula | C27H28N4O8 |
| Molecular Weight | 536.54 g/mol |
| Exact Mass | 536.19 |
| IUPAC Name | 2-[4-[(2S)-butan-2-yl]phenoxy]-N-[(Z)-[4-(2,4-dinitrophenoxy)-3-ethoxyphenyl]methylideneamino]acetamide |
| SMILES | CCOc1cc(/C=N\NC(=O)COc2ccc([C@@H](C)CC)cc2)ccc1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H28N4O8/c1-4-18(3)20-7-10-22(11-8-20)38-17-27(32)29-28-16-19-6-12-25(26(14-19)37-5-2)39-24-13-9-21(30(33)34)15-23(24)31(35)36/h6-16,18H,4-5,17H2,1-3H3,(H,29,32)/b28-16-/t18-/m0/s1 |
| InChIKey | GVTSHFSFMMCUHR-TVEVAFHQSA-N |
| XLogP | 5.74 |
| TPSA | 155.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.54 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|