C29H24N4O8 — CID 19657887
N-[(E)-[4-(2,4-dinitrophenoxy)-3-ethoxyphenyl]methylideneamino]-2-phenylmethoxybenzamide (PubChem CID 19657887) has the molecular formula C29H24N4O8 and a molecular weight of 556.53 g/mol. Its IUPAC name is N-[(E)-[4-(2,4-dinitrophenoxy)-3-ethoxyphenyl]methylideneamino]-2-phenylmethoxybenzamide.
| Compound Name | N-[(E)-[4-(2,4-dinitrophenoxy)-3-ethoxyphenyl]methylideneamino]-2-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 19657887 |
| Molecular Formula | C29H24N4O8 |
| Molecular Weight | 556.53 g/mol |
| Exact Mass | 556.16 |
| IUPAC Name | N-[(E)-[4-(2,4-dinitrophenoxy)-3-ethoxyphenyl]methylideneamino]-2-phenylmethoxybenzamide |
| SMILES | CCOc1cc(/C=N/NC(=O)c2ccccc2OCc2ccccc2)ccc1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C29H24N4O8/c1-2-39-28-16-21(12-14-27(28)41-26-15-13-22(32(35)36)17-24(26)33(37)38)18-30-31-29(34)23-10-6-7-11-25(23)40-19-20-8-4-3-5-9-20/h3-18H,2,19H2,1H3,(H,31,34)/b30-18+ |
| InChIKey | XXJBJGRUWOCEGX-UXHLAJHPSA-N |
| XLogP | 6.04 |
| TPSA | 155.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.53 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|