C30H25Cl2N3O6 — CID 19657564
2-[(2,4-dichlorophenyl)methoxy]-N-[(E)-[3-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]benzamide (PubChem CID 19657564) has the molecular formula C30H25Cl2N3O6 and a molecular weight of 594.45 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methoxy]-N-[(E)-[3-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]benzamide.
| Compound Name | 2-[(2,4-dichlorophenyl)methoxy]-N-[(E)-[3-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 19657564 |
| Molecular Formula | C30H25Cl2N3O6 |
| Molecular Weight | 594.45 g/mol |
| Exact Mass | 593.11 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methoxy]-N-[(E)-[3-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]benzamide |
| SMILES | CCOc1cc(/C=N/NC(=O)c2ccccc2OCc2ccc(Cl)cc2Cl)ccc1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C30H25Cl2N3O6/c1-2-39-29-15-21(9-14-28(29)40-18-20-7-12-24(13-8-20)35(37)38)17-33-34-30(36)25-5-3-4-6-27(25)41-19-22-10-11-23(31)16-26(22)32/h3-17H,2,18-19H2,1H3,(H,34,36)/b33-17+ |
| InChIKey | CHVQBTNOTMRCAH-ATZGPIRCSA-N |
| XLogP | 7.22 |
| TPSA | 112.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.45 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|