C22H19N3O5 — CID 19657832
N-[(E)-(4-methoxy-3-nitrophenyl)methylideneamino]-2-phenylmethoxybenzamide (PubChem CID 19657832) has the molecular formula C22H19N3O5 and a molecular weight of 405.41 g/mol. Its IUPAC name is N-[(E)-(4-methoxy-3-nitrophenyl)methylideneamino]-2-phenylmethoxybenzamide.
| Compound Name | N-[(E)-(4-methoxy-3-nitrophenyl)methylideneamino]-2-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 19657832 |
| Molecular Formula | C22H19N3O5 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | N-[(E)-(4-methoxy-3-nitrophenyl)methylideneamino]-2-phenylmethoxybenzamide |
| SMILES | COc1ccc(/C=N/NC(=O)c2ccccc2OCc2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H19N3O5/c1-29-21-12-11-17(13-19(21)25(27)28)14-23-24-22(26)18-9-5-6-10-20(18)30-15-16-7-3-2-4-8-16/h2-14H,15H2,1H3,(H,24,26)/b23-14+ |
| InChIKey | ZBOALEJKBNACBB-OEAKJJBVSA-N |
| XLogP | 3.95 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|