C29H24IN3O6 — CID 19657835
N-[(E)-[3-iodo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-phenylmethoxybenzamide (PubChem CID 19657835) has the molecular formula C29H24IN3O6 and a molecular weight of 637.43 g/mol. Its IUPAC name is N-[(E)-[3-iodo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-phenylmethoxybenzamide.
| Compound Name | N-[(E)-[3-iodo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 19657835 |
| Molecular Formula | C29H24IN3O6 |
| Molecular Weight | 637.43 g/mol |
| Exact Mass | 637.07 |
| IUPAC Name | N-[(E)-[3-iodo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-phenylmethoxybenzamide |
| SMILES | COc1cc(/C=N/NC(=O)c2ccccc2OCc2ccccc2)cc(I)c1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C29H24IN3O6/c1-37-27-16-22(15-25(30)28(27)39-19-21-11-13-23(14-12-21)33(35)36)17-31-32-29(34)24-9-5-6-10-26(24)38-18-20-7-3-2-4-8-20/h2-17H,18-19H2,1H3,(H,32,34)/b31-17+ |
| InChIKey | KMADTUGRIXYLLL-KBVAKVRCSA-N |
| XLogP | 6.13 |
| TPSA | 112.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.43 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|