C23H20IN3O6 — CID 126156174
N-[(Z)-[3-iodo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-3-methoxybenzamide (PubChem CID 126156174) has the molecular formula C23H20IN3O6 and a molecular weight of 561.33 g/mol. Its IUPAC name is N-[(Z)-[3-iodo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-3-methoxybenzamide.
| Compound Name | N-[(Z)-[3-iodo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-3-methoxybenzamide |
|---|---|
| PubChem CID | 126156174 |
| Molecular Formula | C23H20IN3O6 |
| Molecular Weight | 561.33 g/mol |
| Exact Mass | 561.04 |
| IUPAC Name | N-[(Z)-[3-iodo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)N/N=C\c2cc(I)c(OCc3ccc([N+](=O)[O-])cc3)c(OC)c2)c1 |
| InChI | InChI=1S/C23H20IN3O6/c1-31-19-5-3-4-17(12-19)23(28)26-25-13-16-10-20(24)22(21(11-16)32-2)33-14-15-6-8-18(9-7-15)27(29)30/h3-13H,14H2,1-2H3,(H,26,28)/b25-13- |
| InChIKey | UQRTVIYUDDMDJK-MXAYSNPKSA-N |
| XLogP | 4.56 |
| TPSA | 112.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.33 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|