C29H24IN3O5 — CID 126397766
N-[(E)-[3-iodo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2,2-diphenylacetamide (PubChem CID 126397766) has the molecular formula C29H24IN3O5 and a molecular weight of 621.43 g/mol. Its IUPAC name is N-[(E)-[3-iodo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2,2-diphenylacetamide.
| Compound Name | N-[(E)-[3-iodo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 126397766 |
| Molecular Formula | C29H24IN3O5 |
| Molecular Weight | 621.43 g/mol |
| Exact Mass | 621.08 |
| IUPAC Name | N-[(E)-[3-iodo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2,2-diphenylacetamide |
| SMILES | COc1cc(/C=N/NC(=O)C(c2ccccc2)c2ccccc2)cc(I)c1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C29H24IN3O5/c1-37-26-17-21(16-25(30)28(26)38-19-20-12-14-24(15-13-20)33(35)36)18-31-32-29(34)27(22-8-4-2-5-9-22)23-10-6-3-7-11-23/h2-18,27H,19H2,1H3,(H,32,34)/b31-18+ |
| InChIKey | VYPJMGVLBIFEKM-FDAWAROLSA-N |
| XLogP | 6.07 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.43 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|