C28H21I2N3O5 — CID 19657830
N-[(E)-[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-phenylmethoxybenzamide (PubChem CID 19657830) has the molecular formula C28H21I2N3O5 and a molecular weight of 733.30 g/mol. Its IUPAC name is N-[(E)-[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-phenylmethoxybenzamide.
| Compound Name | N-[(E)-[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 19657830 |
| Molecular Formula | C28H21I2N3O5 |
| Molecular Weight | 733.30 g/mol |
| Exact Mass | 732.96 |
| IUPAC Name | N-[(E)-[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-phenylmethoxybenzamide |
| SMILES | O=C(N/N=C/c1cc(I)c(OCc2ccc([N+](=O)[O-])cc2)c(I)c1)c1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C28H21I2N3O5/c29-24-14-21(15-25(30)27(24)38-18-20-10-12-22(13-11-20)33(35)36)16-31-32-28(34)23-8-4-5-9-26(23)37-17-19-6-2-1-3-7-19/h1-16H,17-18H2,(H,32,34)/b31-16+ |
| InChIKey | GQRNJFOKIWMXCF-WCMJOSRZSA-N |
| XLogP | 6.73 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.30 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|